C24H30N3O10P — CID 123860984
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-3-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123860984) has the molecular formula C24H30N3O10P and a molecular weight of 551.49 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-3-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-3-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123860984 |
| Molecular Formula | C24H30N3O10P |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3-hydroxy-3-methoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#CC1C(n2ccc(=O)[nH]c2=O)OC(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)C1(O)OC |
| InChI | InChI=1S/C24H30N3O10P/c1-6-18-21(27-13-12-20(28)25-23(27)30)36-19(24(18,31)33-5)14-34-38(32,37-17-10-8-7-9-11-17)26-16(4)22(29)35-15(2)3/h1,7-13,15-16,18-19,21,31H,14H2,2-5H3,(H,26,32)(H,25,28,30) |
| InChIKey | POEBHZBUKPGFQF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|