C21H26ClFN3O9P — CID 126676003
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(3-fluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 126676003) has the molecular formula C21H26ClFN3O9P and a molecular weight of 549.88 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(3-fluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(3-fluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126676003 |
| Molecular Formula | C21H26ClFN3O9P |
| Molecular Weight | 549.88 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(3-fluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](Cl)[C@@H]1O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C21H26ClFN3O9P/c1-11(2)33-20(29)12(3)25-36(31,35-14-6-4-5-13(23)9-14)32-10-15-18(28)17(22)19(34-15)26-8-7-16(27)24-21(26)30/h4-9,11-12,15,17-19,28H,10H2,1-3H3,(H,25,31)(H,24,27,30)/t12-,15+,17-,18+,19+,36?/m0/s1 |
| InChIKey | XLRGUEISLSZMHN-JSSSLWRASA-N |
| XLogP | 1.67 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|