C29H41ClN3O11P — CID 126493383
bis(3-methylbutyl) (2S)-2-[[[(2R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate (PubChem CID 126493383) has the molecular formula C29H41ClN3O11P and a molecular weight of 674.08 g/mol. Its IUPAC name is bis(3-methylbutyl) (2S)-2-[[[(2R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | bis(3-methylbutyl) (2S)-2-[[[(2R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 126493383 |
| Molecular Formula | C29H41ClN3O11P |
| Molecular Weight | 674.08 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | bis(3-methylbutyl) (2S)-2-[[[(2R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
| SMILES | CC(C)CCOC(=O)C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](Cl)C1O)Oc1ccccc1)C(=O)OCCC(C)C |
| InChI | InChI=1S/C29H41ClN3O11P/c1-18(2)11-14-40-24(35)16-21(28(37)41-15-12-19(3)4)32-45(39,44-20-8-6-5-7-9-20)42-17-22-26(36)25(30)27(43-22)33-13-10-23(34)31-29(33)38/h5-10,13,18-19,21-22,25-27,36H,11-12,14-17H2,1-4H3,(H,32,39)(H,31,34,38)/t21-,22+,25+,26?,27+,45?/m0/s1 |
| InChIKey | NLAZXXPMMZSLNY-UXJVVJJGSA-N |
| XLogP | 3.13 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|