C32H41N4O11P — CID 163527065
4-O-benzyl 1-O-(3-methylbutyl) (2S)-2-[[[(2R,3S,4R,5R)-5-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate (PubChem CID 163527065) has the molecular formula C32H41N4O11P and a molecular weight of 688.67 g/mol. Its IUPAC name is 4-O-benzyl 1-O-(3-methylbutyl) (2S)-2-[[[(2R,3S,4R,5R)-5-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | 4-O-benzyl 1-O-(3-methylbutyl) (2S)-2-[[[(2R,3S,4R,5R)-5-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 163527065 |
| Molecular Formula | C32H41N4O11P |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | 4-O-benzyl 1-O-(3-methylbutyl) (2S)-2-[[[(2R,3S,4R,5R)-5-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
| SMILES | C=C(N)c1ncn([C@@H]2O[C@H](COP(=O)(N[C@@H](CC(=O)OCc3ccccc3)C(=O)OCCC(C)C)Oc3ccccc3)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C32H41N4O11P/c1-20(2)14-15-43-32(41)24(16-26(37)44-17-22-10-6-4-7-11-22)35-48(42,47-23-12-8-5-9-13-23)45-18-25-28(38)29(39)31(46-25)36-19-34-27(21(3)33)30(36)40/h4-13,19-20,24-25,28-29,31,38-40H,3,14-18,33H2,1-2H3,(H,35,42)/t24-,25+,28+,29+,31+,48?/m0/s1 |
| InChIKey | LXAQLLKBPXVVRL-KPBHQMKSSA-N |
| XLogP | 3.02 |
| TPSA | 213.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|