C29H43ClN3O10P — CID 123720245
bis(3-methylbutyl) 2-[[[4-chloro-3-hydroxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate (PubChem CID 123720245) has the molecular formula C29H43ClN3O10P and a molecular weight of 660.10 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-[[[4-chloro-3-hydroxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | bis(3-methylbutyl) 2-[[[4-chloro-3-hydroxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 123720245 |
| Molecular Formula | C29H43ClN3O10P |
| Molecular Weight | 660.10 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | bis(3-methylbutyl) 2-[[[4-chloro-3-hydroxy-5-(6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
| SMILES | CC(C)CCOC(=O)CC(NP(=O)(OCC1OC(N2C=CC(=O)NC2)C(Cl)C1O)Oc1ccccc1)C(=O)OCCC(C)C |
| InChI | InChI=1S/C29H43ClN3O10P/c1-19(2)11-14-39-25(35)16-22(29(37)40-15-12-20(3)4)32-44(38,43-21-8-6-5-7-9-21)41-17-23-27(36)26(30)28(42-23)33-13-10-24(34)31-18-33/h5-10,13,19-20,22-23,26-28,36H,11-12,14-18H2,1-4H3,(H,31,34)(H,32,38) |
| InChIKey | YEIPTJFWRPZYHU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|