C22H31N4O9P — CID 165068935
2-methylpropyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 165068935) has the molecular formula C22H31N4O9P and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-methylpropyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-methylpropyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 165068935 |
| Molecular Formula | C22H31N4O9P |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 2-methylpropyl (2S)-2-[[[(2R,4S,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1NC(=O)C=NN1[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)C)Oc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C22H31N4O9P/c1-13(2)11-32-22(30)14(3)25-36(31,35-16-8-6-5-7-9-16)33-12-17-19(28)20(29)21(34-17)26-15(4)24-18(27)10-23-26/h5-10,13-14,17,19-21,28-29H,4,11-12H2,1-3H3,(H,24,27)(H,25,31)/t14-,17+,19?,20-,21+,36?/m0/s1 |
| InChIKey | DRHWFRNTVLNBPZ-KNDIJFEUSA-N |
| XLogP | 0.70 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|