C23H28N5O9P — CID 130206943
methyl (2S)-2-[[[(2R,3S,4R,5R)-5-(5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 130206943) has the molecular formula C23H28N5O9P and a molecular weight of 549.48 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5R)-5-(5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-5-(5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130206943 |
| Molecular Formula | C23H28N5O9P |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-5-(5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cc(C(N)=O)c3cnc(C)nc32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H28N5O9P/c1-12(23(32)34-3)27-38(33,37-14-7-5-4-6-8-14)35-11-17-18(29)19(30)22(36-17)28-10-16(20(24)31)15-9-25-13(2)26-21(15)28/h4-10,12,17-19,22,29-30H,11H2,1-3H3,(H2,24,31)(H,27,33)/t12-,17+,18+,19+,22+,38?/m0/s1 |
| InChIKey | RKZJWCKJELIFGN-JQNZKGRISA-N |
| XLogP | 0.81 |
| TPSA | 197.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|