C23H28ClN4O8P — CID 118119326
propan-2-yl (2R)-2-[[[(2R,3S,4R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118119326) has the molecular formula C23H28ClN4O8P and a molecular weight of 554.92 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118119326 |
| Molecular Formula | C23H28ClN4O8P |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1OC(n2ccc3c(Cl)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H28ClN4O8P/c1-13(2)34-23(31)14(3)27-37(32,36-15-7-5-4-6-8-15)33-11-17-18(29)19(30)22(35-17)28-10-9-16-20(24)25-12-26-21(16)28/h4-10,12-14,17-19,22,29-30H,11H2,1-3H3,(H,27,32)/t14-,17-,18-,19-,22?,37?/m1/s1 |
| InChIKey | IGJBTABRUAJTGJ-RAMOQADCSA-N |
| XLogP | 2.84 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|