C22H28FN6O8P — CID 118119537
propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118119537) has the molecular formula C22H28FN6O8P and a molecular weight of 554.47 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118119537 |
| Molecular Formula | C22H28FN6O8P |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28FN6O8P/c1-11(2)35-21(32)12(3)28-38(33,37-13-7-5-4-6-8-13)34-9-14-16(30)17(31)20(36-14)29-10-25-15-18(24)26-22(23)27-19(15)29/h4-8,10-12,14,16-17,20,30-31H,9H2,1-3H3,(H,28,33)(H2,24,26,27)/t12-,14-,16-,17+,20-,38?/m1/s1 |
| InChIKey | CFPNIFHOOXJSSE-QAPXKNTOSA-N |
| XLogP | 1.30 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|