C20H24FN6O8P — CID 11848810
methyl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 11848810) has the molecular formula C20H24FN6O8P and a molecular weight of 526.42 g/mol. Its IUPAC name is methyl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 11848810 |
| Molecular Formula | C20H24FN6O8P |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | methyl (2R)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H24FN6O8P/c1-10(19(30)32-2)26-36(31,35-11-6-4-3-5-7-11)33-8-12-14(28)15(29)18(34-12)27-9-23-13-16(22)24-20(21)25-17(13)27/h3-7,9-10,12,14-15,18,28-29H,8H2,1-2H3,(H,26,31)(H2,22,24,25)/t10-,12-,14-,15+,18-,36?/m1/s1 |
| InChIKey | OLLAKCAGLYHYCP-JTPZXHBRSA-N |
| XLogP | 0.52 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|