C22H31N8O7P — CID 90445043
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90445043) has the molecular formula C22H31N8O7P and a molecular weight of 550.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90445043 |
| Molecular Formula | C22H31N8O7P |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-4-amino-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](N)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H31N8O7P/c1-11(2)35-21(32)12(3)29-38(33,37-13-7-5-4-6-8-13)34-9-14-17(31)15(23)20(36-14)30-10-26-16-18(24)27-22(25)28-19(16)30/h4-8,10-12,14-15,17,20,31H,9,23H2,1-3H3,(H,29,33)(H4,24,25,27,28)/t12-,14+,15+,17+,20+,38-/m0/s1 |
| InChIKey | MMKKCMYAZAYPPX-YZKHFHAJSA-N |
| XLogP | 0.71 |
| TPSA | 224.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|