C22H28Cl2N7O7P — CID 118126165
propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118126165) has the molecular formula C22H28Cl2N7O7P and a molecular weight of 604.39 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118126165 |
| Molecular Formula | C22H28Cl2N7O7P |
| Molecular Weight | 604.39 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)C(Cl)(Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28Cl2N7O7P/c1-11(2)36-19(33)12(3)30-39(34,38-13-7-5-4-6-8-13)35-9-14-16(32)22(23,24)20(37-14)31-10-27-15-17(25)28-21(26)29-18(15)31/h4-8,10-12,14,16,20,32H,9H2,1-3H3,(H,30,34)(H4,25,26,28,29)/t12-,14-,16-,20-,39-/m1/s1 |
| InChIKey | DLWHSIOOLYJHNA-YXLDIDOKSA-N |
| XLogP | 2.56 |
| TPSA | 198.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|