C26H32ClF3N7O7P — CID 156841771
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-chloro-3-hydroxy-4-(trifluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156841771) has the molecular formula C26H32ClF3N7O7P and a molecular weight of 678.01 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-chloro-3-hydroxy-4-(trifluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-chloro-3-hydroxy-4-(trifluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156841771 |
| Molecular Formula | C26H32ClF3N7O7P |
| Molecular Weight | 678.01 g/mol |
| Exact Mass | 677.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-chloro-3-hydroxy-4-(trifluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(N)nc32)[C@@](Cl)(C(F)(F)F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H32ClF3N7O7P/c1-13(2)42-22(39)14(3)36-45(40,44-16-7-5-4-6-8-16)41-11-17-19(38)25(27,26(28,29)30)23(43-17)37-12-32-18-20(33-15-9-10-15)34-24(31)35-21(18)37/h4-8,12-15,17,19,23,38H,9-11H2,1-3H3,(H,36,40)(H3,31,33,34,35)/t14-,17+,19+,23+,25+,45-/m0/s1 |
| InChIKey | NSPOQCYOUMYHDT-RHVUYZBISA-N |
| XLogP | 3.91 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.01 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|