C27H37FN7O7P — CID 122532098
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclobutylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122532098) has the molecular formula C27H37FN7O7P and a molecular weight of 621.61 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclobutylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclobutylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122532098 |
| Molecular Formula | C27H37FN7O7P |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclobutylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(NC4CCC4)nc(N)nc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H37FN7O7P/c1-15(2)40-24(37)16(3)34-43(38,42-18-11-6-5-7-12-18)39-13-19-21(36)27(4,28)25(41-19)35-14-30-20-22(31-17-9-8-10-17)32-26(29)33-23(20)35/h5-7,11-12,14-17,19,21,25,36H,8-10,13H2,1-4H3,(H,34,38)(H3,29,31,32,33)/t16-,19+,21+,25+,27+,43?/m0/s1 |
| InChIKey | SEUKVXHMNNLVMN-YLFSJPCFSA-N |
| XLogP | 3.49 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|