C25H33FN7O8P — CID 156841918
ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156841918) has the molecular formula C25H33FN7O8P and a molecular weight of 609.55 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156841918 |
| Molecular Formula | C25H33FN7O8P |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)C(C)N[P@@](=O)(OC[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(N)nc32)[C@@](F)(CO)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H33FN7O8P/c1-3-38-22(36)14(2)32-42(37,41-16-7-5-4-6-8-16)39-11-17-19(35)25(26,12-34)23(40-17)33-13-28-18-20(29-15-9-10-15)30-24(27)31-21(18)33/h4-8,13-15,17,19,23,34-35H,3,9-12H2,1-2H3,(H,32,37)(H3,27,29,30,31)/t14?,17-,19-,23-,25-,42-/m1/s1 |
| InChIKey | AYQHHKLLRTVUBL-LDLFBMIVSA-N |
| XLogP | 1.69 |
| TPSA | 205.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|