C26H33FN7O7P — CID 166015876
ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015876) has the molecular formula C26H33FN7O7P and a molecular weight of 605.56 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015876 |
| Molecular Formula | C26H33FN7O7P |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@@]1(F)[C@H](O)[C@@H](CO[P@](=O)(NC(C)C(=O)OCC)Oc2ccccc2)O[C@H]1n1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C26H33FN7O7P/c1-4-26(27)20(35)18(13-39-42(37,33-15(3)23(36)38-5-2)41-17-9-7-6-8-10-17)40-24(26)34-14-29-19-21(30-16-11-12-16)31-25(28)32-22(19)34/h4,6-10,14-16,18,20,24,35H,1,5,11-13H2,2-3H3,(H,33,37)(H3,28,30,31,32)/t15?,18-,20-,24-,26-,42-/m1/s1 |
| InChIKey | VICSVINTWABOIX-YBDFBISHSA-N |
| XLogP | 2.88 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|