C25H31F3N7O7P — CID 166015764
ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015764) has the molecular formula C25H31F3N7O7P and a molecular weight of 629.53 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015764 |
| Molecular Formula | C25H31F3N7O7P |
| Molecular Weight | 629.53 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-(difluoromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)C(C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(N)nc32)[C@@](F)(C(F)F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H31F3N7O7P/c1-3-39-21(37)13(2)34-43(38,42-15-7-5-4-6-8-15)40-11-16-18(36)25(28,22(26)27)23(41-16)35-12-30-17-19(31-14-9-10-14)32-24(29)33-20(17)35/h4-8,12-14,16,18,22-23,36H,3,9-11H2,1-2H3,(H,34,38)(H3,29,31,32,33)/t13?,16-,18-,23-,25+,43+/m1/s1 |
| InChIKey | WHGTUKGPGIMMQP-YXQLJFTNSA-N |
| XLogP | 2.96 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|