C23H29ClF2N7O7P — CID 166015995
ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(difluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015995) has the molecular formula C23H29ClF2N7O7P and a molecular weight of 619.95 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(difluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(difluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015995 |
| Molecular Formula | C23H29ClF2N7O7P |
| Molecular Weight | 619.95 g/mol |
| Exact Mass | 619.15 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(difluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(NC)nc(N)nc32)[C@@](Cl)(C(F)F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H29ClF2N7O7P/c1-4-37-19(35)12(2)32-41(36,40-13-8-6-5-7-9-13)38-10-14-16(34)23(24,20(25)26)21(39-14)33-11-29-15-17(28-3)30-22(27)31-18(15)33/h5-9,11-12,14,16,20-21,34H,4,10H2,1-3H3,(H,32,36)(H3,27,28,30,31)/t12-,14-,16-,21-,23+,41+/m1/s1 |
| InChIKey | JFKQTKPOFMVCSY-WUNFACDLSA-N |
| XLogP | 2.70 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|