C23H30ClFN7O7P — CID 166015703
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015703) has the molecular formula C23H30ClFN7O7P and a molecular weight of 601.96 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015703 |
| Molecular Formula | C23H30ClFN7O7P |
| Molecular Weight | 601.96 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(NC)nc(N)nc32)[C@@](Cl)(CF)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H30ClFN7O7P/c1-4-36-20(34)13(2)31-40(35,39-14-8-6-5-7-9-14)37-10-15-17(33)23(24,11-25)21(38-15)32-12-28-16-18(27-3)29-22(26)30-19(16)32/h5-9,12-13,15,17,21,33H,4,10-11H2,1-3H3,(H,31,35)(H3,26,27,29,30)/t13-,15+,17+,21+,23+,40-/m0/s1 |
| InChIKey | GTSJPXBKCRAXDO-YIDBGPRWSA-N |
| XLogP | 2.40 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.96 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|