C24H32F2N7O7P — CID 156841786
propan-2-yl (2S)-2-[[[(4R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156841786) has the molecular formula C24H32F2N7O7P and a molecular weight of 599.53 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(4R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(4R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156841786 |
| Molecular Formula | C24H32F2N7O7P |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(4R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CNc1nc(N)nc2c1ncn2C1OC(CO[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)C(O)[C@]1(F)CF |
| InChI | InChI=1S/C24H32F2N7O7P/c1-13(2)38-21(35)14(3)32-41(36,40-15-8-6-5-7-9-15)37-10-16-18(34)24(26,11-25)22(39-16)33-12-29-17-19(28-4)30-23(27)31-20(17)33/h5-9,12-14,16,18,22,34H,10-11H2,1-4H3,(H,32,36)(H3,27,28,30,31)/t14-,16?,18?,22?,24+,41+/m0/s1 |
| InChIKey | GPWUWDXIOHQAEP-RTMQSFTPSA-N |
| XLogP | 2.52 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|