C25H31ClN7O7P — CID 166016041
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166016041) has the molecular formula C25H31ClN7O7P and a molecular weight of 607.99 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166016041 |
| Molecular Formula | C25H31ClN7O7P |
| Molecular Weight | 607.99 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(Cl)[C@H](O)[C@@H](COP(=O)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C25H31ClN7O7P/c1-6-25(26)19(34)17(39-23(25)33-13-29-18-20(28-5)30-24(27)31-21(18)33)12-37-41(36,40-16-10-8-7-9-11-16)32-15(4)22(35)38-14(2)3/h1,7-11,13-15,17,19,23,34H,12H2,2-5H3,(H,32,36)(H3,27,28,30,31)/t15-,17-,19-,23-,25-,41?/m1/s1 |
| InChIKey | YRVVAHWJPNMQLQ-IAAMWGKKSA-N |
| XLogP | 2.45 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.99 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|