C24H31FN7O7P — CID 156841839
ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156841839) has the molecular formula C24H31FN7O7P and a molecular weight of 579.53 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156841839 |
| Molecular Formula | C24H31FN7O7P |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@@]1(F)[C@H](O)[C@@H](CO[P@](=O)(NC(C)C(=O)OCC)Oc2ccccc2)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C24H31FN7O7P/c1-5-24(25)18(33)16(38-22(24)32-13-28-17-19(27-4)29-23(26)30-20(17)32)12-37-40(35,31-14(3)21(34)36-6-2)39-15-10-8-7-9-11-15/h5,7-11,13-14,16,18,22,33H,1,6,12H2,2-4H3,(H,31,35)(H3,26,27,29,30)/t14?,16-,18-,22-,24-,40-/m1/s1 |
| InChIKey | OGOVZRPYDSIMMW-VFCANFFESA-N |
| XLogP | 2.35 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|