C25H32FN6O7P — CID 166015946
propan-2-yl 2-[[[(2R,3R,4R,5R)-4-ethenyl-4-fluoro-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015946) has the molecular formula C25H32FN6O7P and a molecular weight of 578.54 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-4-ethenyl-4-fluoro-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-ethenyl-4-fluoro-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015946 |
| Molecular Formula | C25H32FN6O7P |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-ethenyl-4-fluoro-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@@]1(F)[C@H](O)[C@@H](COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1cnc2c(NC)ncnc21 |
| InChI | InChI=1S/C25H32FN6O7P/c1-6-25(26)20(33)18(38-24(25)32-14-30-19-21(27-5)28-13-29-22(19)32)12-36-40(35,39-17-10-8-7-9-11-17)31-16(4)23(34)37-15(2)3/h6-11,13-16,18,20,24,33H,1,12H2,2-5H3,(H,31,35)(H,27,28,29)/t16?,18-,20-,24-,25-,40?/m1/s1 |
| InChIKey | FFGHAFVCNBTLLN-APTJKFDTSA-N |
| XLogP | 3.15 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|