C27H38FN6O7P — CID 166015729
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[6-(butylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015729) has the molecular formula C27H38FN6O7P and a molecular weight of 608.61 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[6-(butylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[6-(butylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015729 |
| Molecular Formula | C27H38FN6O7P |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[6-(butylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C27H38FN6O7P/c1-6-7-13-29-23-21-24(31-15-30-23)34(16-32-21)26-27(5,28)22(35)20(40-26)14-38-42(37,41-19-11-9-8-10-12-19)33-18(4)25(36)39-17(2)3/h8-12,15-18,20,22,26,35H,6-7,13-14H2,1-5H3,(H,33,37)(H,29,30,31)/t18-,20+,22+,26+,27+,42-/m0/s1 |
| InChIKey | QPYZYNGNMCNWNI-DONZORQFSA-N |
| XLogP | 4.16 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|