C22H27BrFN6O7P — CID 155513201
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155513201) has the molecular formula C22H27BrFN6O7P and a molecular weight of 617.37 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155513201 |
| Molecular Formula | C22H27BrFN6O7P |
| Molecular Weight | 617.37 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@](F)(Br)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H27BrFN6O7P/c1-12(2)35-20(32)13(3)29-38(33,37-14-7-5-4-6-8-14)34-9-15-17(31)22(23,24)21(36-15)30-11-28-16-18(25)26-10-27-19(16)30/h4-8,10-13,15,17,21,31H,9H2,1-3H3,(H,29,33)(H2,25,26,27)/t13-,15+,17+,21+,22-,38?/m0/s1 |
| InChIKey | ZJJYOQHSVZJUGN-CPZIOUKOSA-N |
| XLogP | 2.86 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|