C25H34FN6O6P — CID 139293840
propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-3,5-dimethylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 139293840) has the molecular formula C25H34FN6O6P and a molecular weight of 564.56 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-3,5-dimethylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-3,5-dimethylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139293840 |
| Molecular Formula | C25H34FN6O6P |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-3,5-dimethylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1[C@H](C)[C@@H](n2cnc3c(N)ncnc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H34FN6O6P/c1-14(2)37-24(34)16(4)31-39(35,38-17-9-7-6-8-10-17)36-11-18-15(3)20(25(5,26)21(18)33)32-13-30-19-22(27)28-12-29-23(19)32/h6-10,12-16,18,20-21,33H,11H2,1-5H3,(H,31,35)(H2,27,28,29)/t15-,16-,18-,20+,21+,25-,39-/m0/s1 |
| InChIKey | YPCJHTVTIWULOU-SMZMERNNSA-N |
| XLogP | 3.44 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|