C22H26FN6O6P — CID 71533662
methyl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 71533662) has the molecular formula C22H26FN6O6P and a molecular weight of 520.46 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71533662 |
| Molecular Formula | C22H26FN6O6P |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | methyl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1[C@@H](n2cnc3c(N)ncnc32)[C@@H](F)[C@H](O)[C@H]1COP(=O)(N[C@@H](C)C(=O)OC)Oc1ccccc1 |
| InChI | InChI=1S/C22H26FN6O6P/c1-12-15(19(30)16(23)18(12)29-11-27-17-20(24)25-10-26-21(17)29)9-34-36(32,28-13(2)22(31)33-3)35-14-7-5-4-6-8-14/h4-8,10-11,13,15-16,18-19,30H,1,9H2,2-3H3,(H,28,32)(H2,24,25,26)/t13-,15-,16+,18+,19+,36?/m0/s1 |
| InChIKey | POBLQHUCZZQDHY-VXJGCUOCSA-N |
| XLogP | 2.19 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|