C20H25N6O6P — CID 169427831
(3S)-3-[[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butan-2-one (PubChem CID 169427831) has the molecular formula C20H25N6O6P and a molecular weight of 476.43 g/mol. Its IUPAC name is (3S)-3-[[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butan-2-one.
| Compound Name | (3S)-3-[[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butan-2-one |
|---|---|
| PubChem CID | 169427831 |
| Molecular Formula | C20H25N6O6P |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (3S)-3-[[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butan-2-one |
| SMILES | CC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H25N6O6P/c1-12(13(2)27)25-33(29,32-14-6-4-3-5-7-14)30-9-16-15(28)8-17(31-16)26-11-24-18-19(21)22-10-23-20(18)26/h3-7,10-12,15-17,28H,8-9H2,1-2H3,(H,25,29)(H2,21,22,23)/t12-,15+,16+,17+,33?/m0/s1 |
| InChIKey | NOKJNKZGAXFCLY-TUVNSDJOSA-N |
| XLogP | 1.83 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|