C25H35N6O7P — CID 176945058
2-ethylbutyl (2S)-2-[[[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 176945058) has the molecular formula C25H35N6O7P and a molecular weight of 562.56 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 176945058 |
| Molecular Formula | C25H35N6O7P |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C25H35N6O7P/c1-4-17(5-2)12-35-25(33)16(3)30-39(34,38-18-9-7-6-8-10-18)36-13-19-11-20(32)24(37-19)31-15-29-21-22(26)27-14-28-23(21)31/h6-10,14-17,19-20,24,32H,4-5,11-13H2,1-3H3,(H,30,34)(H2,26,27,28)/t16-,19-,20+,24+,39?/m0/s1 |
| InChIKey | YYJMAXLWRILAEV-LCVOLOCFSA-N |
| XLogP | 3.22 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|