C27H31N6O8P — CID 130403869
benzyl (2S)-2-[[[(2S,4S)-5-(6-amino-2-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 130403869) has the molecular formula C27H31N6O8P and a molecular weight of 598.55 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2S,4S)-5-(6-amino-2-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2S,4S)-5-(6-amino-2-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130403869 |
| Molecular Formula | C27H31N6O8P |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | benzyl (2S)-2-[[[(2S,4S)-5-(6-amino-2-methoxypurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)c2ncn(C3O[C@H](COP(=O)(N[C@@H](C)C(=O)OCc4ccccc4)Oc4ccccc4)C[C@@H]3O)c2n1 |
| InChI | InChI=1S/C27H31N6O8P/c1-17(26(35)38-14-18-9-5-3-6-10-18)32-42(36,41-19-11-7-4-8-12-19)39-15-20-13-21(34)25(40-20)33-16-29-22-23(28)30-27(37-2)31-24(22)33/h3-12,16-17,20-21,25,34H,13-15H2,1-2H3,(H,32,36)(H2,28,30,31)/t17-,20-,21-,25?,42?/m0/s1 |
| InChIKey | RJTZBZVUBWUXEQ-LPDCACKWSA-N |
| XLogP | 2.99 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|