C28H35N6O7P — CID 167691457
benzyl (2S)-2-[[[(2S,5R)-5-[(6-aminopurin-9-yl)methyl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;methanol (PubChem CID 167691457) has the molecular formula C28H35N6O7P and a molecular weight of 598.60 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2S,5R)-5-[(6-aminopurin-9-yl)methyl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;methanol.
| Compound Name | benzyl (2S)-2-[[[(2S,5R)-5-[(6-aminopurin-9-yl)methyl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;methanol |
|---|---|
| PubChem CID | 167691457 |
| Molecular Formula | C28H35N6O7P |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | benzyl (2S)-2-[[[(2S,5R)-5-[(6-aminopurin-9-yl)methyl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;methanol |
| SMILES | CO.C[C@H](NP(=O)(OC[C@@H]1CC[C@H](Cn2cnc3c(N)ncnc32)O1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N6O6P.CH4O/c1-19(27(34)36-15-20-8-4-2-5-9-20)32-40(35,39-21-10-6-3-7-11-21)37-16-23-13-12-22(38-23)14-33-18-31-24-25(28)29-17-30-26(24)33;1-2/h2-11,17-19,22-23H,12-16H2,1H3,(H,32,35)(H2,28,29,30);2H,1H3/t19-,22+,23-,40?;/m0./s1 |
| InChIKey | WZXTUVBAHVYFRS-UIPUCGMASA-N |
| XLogP | 3.49 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|