C20H24FN6O6P — CID 155679792
methyl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155679792) has the molecular formula C20H24FN6O6P and a molecular weight of 494.42 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155679792 |
| Molecular Formula | C20H24FN6O6P |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | methyl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C[C@H](F)[C@H](n2cnc3c(N)ncnc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C20H24FN6O6P/c1-12(20(28)30-2)26-34(29,33-13-6-4-3-5-7-13)31-9-14-8-15(21)19(32-14)27-11-25-16-17(22)23-10-24-18(16)27/h3-7,10-12,14-15,19H,8-9H2,1-2H3,(H,26,29)(H2,22,23,24)/t12-,14-,15-,19+,34?/m0/s1 |
| InChIKey | XLFTZQZRNRCMLO-VVGKRHCPSA-N |
| XLogP | 2.39 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|