C21H25N6O5P — CID 10322564
methyl 2-[[[(2S,5S)-2-(6-aminopurin-9-yl)spiro[2.2]pentan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 10322564) has the molecular formula C21H25N6O5P and a molecular weight of 472.44 g/mol. Its IUPAC name is methyl 2-[[[(2S,5S)-2-(6-aminopurin-9-yl)spiro[2.2]pentan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[(2S,5S)-2-(6-aminopurin-9-yl)spiro[2.2]pentan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 10322564 |
| Molecular Formula | C21H25N6O5P |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl 2-[[[(2S,5S)-2-(6-aminopurin-9-yl)spiro[2.2]pentan-5-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OC[C@H]1CC12C[C@@H]2n1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C21H25N6O5P/c1-13(20(28)30-2)26-33(29,32-15-6-4-3-5-7-15)31-10-14-8-21(14)9-16(21)27-12-25-17-18(22)23-11-24-19(17)27/h3-7,11-14,16H,8-10H2,1-2H3,(H,26,29)(H2,22,23,24)/t13?,14-,16+,21?,33?/m1/s1 |
| InChIKey | NWPCOGHPKICYAZ-YMBKWXCASA-N |
| XLogP | 2.71 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|