C22H27N6O7P — CID 134215241
prop-2-enyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134215241) has the molecular formula C22H27N6O7P and a molecular weight of 518.47 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | prop-2-enyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134215241 |
| Molecular Formula | C22H27N6O7P |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | prop-2-enyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=CCOC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H27N6O7P/c1-3-9-32-22(30)14(2)27-36(31,35-15-7-5-4-6-8-15)33-11-17-16(29)10-18(34-17)28-13-26-19-20(23)24-12-25-21(19)28/h3-8,12-14,16-18,29H,1,9-11H2,2H3,(H,27,31)(H2,23,24,25)/t14-,16-,17+,18+,36-/m0/s1 |
| InChIKey | ZNCDNXQIWPTZOZ-QZIFRADZSA-N |
| XLogP | 1.97 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|