C22H29N6O7PS — CID 118119745
propan-2-yl (2R)-2-[[[(2R,3S)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118119745) has the molecular formula C22H29N6O7PS and a molecular weight of 552.55 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118119745 |
| Molecular Formula | C22H29N6O7PS |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1OC(n2cnc3c(=S)nc(N)[nH]c32)C[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29N6O7PS/c1-12(2)33-21(30)13(3)27-36(31,35-14-7-5-4-6-8-14)32-10-16-15(29)9-17(34-16)28-11-24-18-19(28)25-22(23)26-20(18)37/h4-8,11-13,15-17,29H,9-10H2,1-3H3,(H,27,31)(H3,23,25,26,37)/t13-,15+,16-,17?,36?/m1/s1 |
| InChIKey | ZFIYTFCPIJYKCF-ADWFVNFVSA-N |
| XLogP | 2.85 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|