C23H31N6O7P — CID 174032595
propan-2-yl 2-[[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate (PubChem CID 174032595) has the molecular formula C23H31N6O7P and a molecular weight of 534.51 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174032595 |
| Molecular Formula | C23H31N6O7P |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | propan-2-yl 2-[[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Cc1ccccc1)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)CC1O |
| InChI | InChI=1S/C23H31N6O7P/c1-13(2)35-22(32)14(3)28-37(33,11-15-7-5-4-6-8-15)34-10-17-16(30)9-18(36-17)29-12-25-19-20(29)26-23(24)27-21(19)31/h4-8,12-14,16-18,30H,9-11H2,1-3H3,(H,28,33)(H3,24,26,27,31)/t14?,16?,17-,18-,37?/m1/s1 |
| InChIKey | OIYDINXLMNBCSM-PLJKIHKJSA-N |
| XLogP | 1.69 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|