C10H14N5NaO6PS+ — CID 54599074
sodium [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 54599074) has the molecular formula C10H14N5NaO6PS+ and a molecular weight of 386.28 g/mol. Its IUPAC name is sodium [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | sodium [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54599074 |
| Molecular Formula | C10H14N5NaO6PS+ |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | sodium [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(=S)c2ncn(C3CC(O)C(COP(=O)(O)O)O3)c2[nH]1.[Na+] |
| InChI | InChI=1S/C10H14N5O6PS.Na/c11-10-13-8-7(9(23)14-10)12-3-15(8)6-1-4(16)5(21-6)2-20-22(17,18)19;/h3-6,16H,1-2H2,(H2,17,18,19)(H3,11,13,14,23);/q;+1 |
| InChIKey | GPBKLAMXHQLCMC-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 168.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|