C10H13N4O8P — CID 25245836
[5-(2,6-dioxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 25245836) has the molecular formula C10H13N4O8P and a molecular weight of 348.21 g/mol. Its IUPAC name is [5-(2,6-dioxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-(2,6-dioxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25245836 |
| Molecular Formula | C10H13N4O8P |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [5-(2,6-dioxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)c2ncn(C3CC(O)C(COP(=O)(O)O)O3)c2[nH]1 |
| InChI | InChI=1S/C10H13N4O8P/c15-4-1-6(22-5(4)2-21-23(18,19)20)14-3-11-7-8(14)12-10(17)13-9(7)16/h3-6,15H,1-2H2,(H2,18,19,20)(H2,12,13,16,17) |
| InChIKey | RTWWRSBEQVIVBY-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|