C10H13N4NaO7P — CID 135705215
2'-Deoxyinosine-5'-phosphate sodium (PubChem CID 135705215) has the molecular formula C10H13N4NaO7P and a molecular weight of 355.20 g/mol.
| Compound Name | 2'-Deoxyinosine-5'-phosphate sodium |
|---|---|
| PubChem CID | 135705215 |
| Molecular Formula | C10H13N4NaO7P |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | — |
| SMILES | O=c1[nH]cnc2c1ncn2C1CC(O)C(COP(=O)(O)O)O1.[Na] |
| InChI | InChI=1S/C10H13N4O7P.Na/c15-5-1-7(21-6(5)2-20-22(17,18)19)14-4-13-8-9(14)11-3-12-10(8)16;/h3-7,15H,1-2H2,(H,11,12,16)(H2,17,18,19); |
| InChIKey | CUTSQLZMRYTJHJ-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|