C10H11N7O3 — CID 172642337
9-[(2R,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 172642337) has the molecular formula C10H11N7O3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 9-[(2R,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 172642337 |
| Molecular Formula | C10H11N7O3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 9-[(2R,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)CC1O |
| InChI | InChI=1S/C10H11N7O3/c11-16-15-2-6-5(18)1-7(20-6)17-4-14-8-9(17)12-3-13-10(8)19/h3-7,18H,1-2H2,(H,12,13,19)/t5?,6-,7-/m1/s1 |
| InChIKey | NWVPQMPRXFNQJH-JXBXZBNISA-N |
| XLogP | 0.08 |
| TPSA | 141.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|