C9H10N4O3 — CID 135856505
9-[4-(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one (PubChem CID 135856505) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 9-[4-(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[4-(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135856505 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 9-[4-(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2C1CC(CO)O1 |
| InChI | InChI=1S/C9H10N4O3/c14-2-5-1-6(16-5)13-4-12-7-8(13)10-3-11-9(7)15/h3-6,14H,1-2H2,(H,10,11,15) |
| InChIKey | IIDXGOJXHJDDJT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |