C12H15N5O3 — CID 135497016
9-[(2R,4R,5S)-4-ethanimidoyl-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135497016) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 9-[(2R,4R,5S)-4-ethanimidoyl-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,4R,5S)-4-ethanimidoyl-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135497016 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 9-[(2R,4R,5S)-4-ethanimidoyl-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [H]/N=C(\C)[C@H]1C[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@H]1CO |
| InChI | InChI=1S/C12H15N5O3/c1-6(13)7-2-9(20-8(7)3-18)17-5-16-10-11(17)14-4-15-12(10)19/h4-5,7-9,13,18H,2-3H2,1H3,(H,14,15,19)/b13-6+/t7-,8-,9-/m1/s1 |
| InChIKey | ZPRWKKMDEBKTPT-IOLVEUEHSA-N |
| XLogP | 0.06 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|