C12H16N4O3 — CID 138506458
9-[(2R,3R,4S)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1H-purin-6-one (PubChem CID 138506458) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 9-[(2R,3R,4S)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 138506458 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 9-[(2R,3R,4S)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1H-purin-6-one |
| SMILES | C[C@@H]1[C@H](C)C(CO)O[C@H]1n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C12H16N4O3/c1-6-7(2)12(19-8(6)3-17)16-5-15-9-10(16)13-4-14-11(9)18/h4-8,12,17H,3H2,1-2H3,(H,13,14,18)/t6-,7+,8?,12+/m0/s1 |
| InChIKey | BYGSOBBPRXUUIV-LCUVYINJSA-N |
| XLogP | 0.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |