C10H12HgN4O5 — CID 175730179
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;mercury (PubChem CID 175730179) has the molecular formula C10H12HgN4O5 and a molecular weight of 468.82 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;mercury.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;mercury |
|---|---|
| PubChem CID | 175730179 |
| Molecular Formula | C10H12HgN4O5 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;mercury |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.[Hg] |
| InChI | InChI=1S/C10H12N4O5.Hg/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | OLUFVHBWPLXUCC-MCDZGGTQSA-N |
| XLogP | -2.27 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|