C10H16N4O12P2 — CID 135782737
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphono dihydrogen phosphate (PubChem CID 135782737) has the molecular formula C10H16N4O12P2 and a molecular weight of 446.20 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphono dihydrogen phosphate.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 135782737 |
| Molecular Formula | C10H16N4O12P2 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N4O5.H4O7P2/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;1-8(2,3)7-9(4,5)6/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);(H2,1,2,3)(H2,4,5,6)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | YDMMCCQRDNYQIB-MCDZGGTQSA-N |
| XLogP | -3.08 |
| TPSA | 257.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|