C15H16N8O4 — CID 174945828
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;7H-purine (PubChem CID 174945828) has the molecular formula C15H16N8O4 and a molecular weight of 372.35 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;7H-purine.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;7H-purine |
|---|---|
| PubChem CID | 174945828 |
| Molecular Formula | C15H16N8O4 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;7H-purine |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C10H12N4O4.C5H4N4/c15-2-6-5(16)1-7(18-6)14-4-13-8-9(14)11-3-12-10(8)17;1-4-5(8-2-6-1)9-3-7-4/h3-7,15-16H,1-2H2,(H,11,12,17);1-3H,(H,6,7,8,9)/t5-,6+,7+;/m0./s1 |
| InChIKey | XCGRFJHVIQGOBQ-VWZUFWLJSA-N |
| XLogP | -0.89 |
| TPSA | 167.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |