C10H12N4O4 — CID 135692532
7-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135692532) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 7-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 7-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135692532 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 7-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2ncn([C@@H]3C[C@H](O)[C@@H](CO)O3)c12 |
| InChI | InChI=1S/C10H12N4O4/c15-2-6-5(16)1-7(18-6)14-4-13-9-8(14)10(17)12-3-11-9/h3-7,15-16H,1-2H2,(H,11,12,17)/t5-,6+,7-/m0/s1 |
| InChIKey | KLKIRPUROSYHAE-XVMARJQXSA-N |
| XLogP | -1.24 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |