C8H12N4O4 — CID 76973346
4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 76973346) has the molecular formula C8H12N4O4 and a molecular weight of 233.17 g/mol. Its IUPAC name is 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 76973346 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | Nc1ncn([13C@@H]2[13CH2][13C@H](O)[13C@@H]([13CH2]O)O2)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O4/c9-7-10-3-12(8(15)11-7)6-1-4(14)5(2-13)16-6/h3-6,13-14H,1-2H2,(H2,9,11,15)/t4-,5+,6-/m0/s1/i1+1,2+1,4+1,5+1,6+1 |
| InChIKey | XAUDJQYHKZQPEU-DAKHJNLISA-N |
| XLogP | -2.14 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |