C16H24N8O10 — CID 67397647
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 67397647) has the molecular formula C16H24N8O10 and a molecular weight of 488.41 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 67397647 |
| Molecular Formula | C16H24N8O10 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1.Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/2C8H12N4O5/c2*9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2*2-6,13-15H,1H2,(H2,9,11,16)/t2*3-,4-,5-,6-/m11/s1 |
| InChIKey | LYSDZXGDWHEQSY-KZXKDKCNSA-N |
| XLogP | -6.34 |
| TPSA | 287.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |