C8H12N6O5 — CID 141254642
4-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;molecular nitrogen (PubChem CID 141254642) has the molecular formula C8H12N6O5 and a molecular weight of 272.22 g/mol. Its IUPAC name is 4-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;molecular nitrogen.
| Compound Name | 4-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;molecular nitrogen |
|---|---|
| PubChem CID | 141254642 |
| Molecular Formula | C8H12N6O5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-amino-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;molecular nitrogen |
| SMILES | N#N.Nc1ncn(C2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O5.N2/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6;1-2/h2-6,13-15H,1H2,(H2,9,11,16);/t3-,4-,5-,6?;/m1./s1 |
| InChIKey | LBAWGYYFQLWYNO-MYWCFQFNSA-N |
| XLogP | -3.14 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|